C11H10N2O3 — CID 54351767
2-(oxiran-2-ylmethoxy)-5-phenyl-1,3,4-oxadiazole (PubChem CID 54351767) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxy)-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-(oxiran-2-ylmethoxy)-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 54351767 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-(oxiran-2-ylmethoxy)-5-phenyl-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc(OCC3CO3)o2)cc1 |
| InChI | InChI=1S/C11H10N2O3/c1-2-4-8(5-3-1)10-12-13-11(16-10)15-7-9-6-14-9/h1-5,9H,6-7H2 |
| InChIKey | UGGQQJBMDLDYHZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|