C19H22F3N5O2 — CID 112819537
N-propyl-1-[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxamide (PubChem CID 112819537) has the molecular formula C19H22F3N5O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-propyl-1-[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-propyl-1-[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112819537 |
| Molecular Formula | C19H22F3N5O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-propyl-1-[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxamide |
| SMILES | CCCNC(=O)C1CCN(C(=O)c2cn(-c3ccccc3C(F)(F)F)nn2)CC1 |
| InChI | InChI=1S/C19H22F3N5O2/c1-2-9-23-17(28)13-7-10-26(11-8-13)18(29)15-12-27(25-24-15)16-6-4-3-5-14(16)19(20,21)22/h3-6,12-13H,2,7-11H2,1H3,(H,23,28) |
| InChIKey | AVRBSYPFSQGHPY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |