C18H21F3N6O — CID 120998025
(3-piperazin-1-ylpyrrolidin-1-yl)-[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methanone (PubChem CID 120998025) has the molecular formula C18H21F3N6O and a molecular weight of 394.40 g/mol. Its IUPAC name is (3-piperazin-1-ylpyrrolidin-1-yl)-[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methanone.
| Compound Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methanone |
|---|---|
| PubChem CID | 120998025 |
| Molecular Formula | C18H21F3N6O |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methanone |
| SMILES | O=C(c1cn(-c2ccccc2C(F)(F)F)nn1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C18H21F3N6O/c19-18(20,21)14-3-1-2-4-16(14)27-12-15(23-24-27)17(28)26-8-5-13(11-26)25-9-6-22-7-10-25/h1-4,12-13,22H,5-11H2 |
| InChIKey | CLTBTCITOLJCAU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |