C22H23FN4O3S — CID 112822135
1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]piperidine-3-carboxamide (PubChem CID 112822135) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 112822135 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]piperidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCCN(S(=O)(=O)c3ccccc3)C2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H23FN4O3S/c1-16-14-21(27(25-16)19-11-9-18(23)10-12-19)24-22(28)17-6-5-13-26(15-17)31(29,30)20-7-3-2-4-8-20/h2-4,7-12,14,17H,5-6,13,15H2,1H3,(H,24,28) |
| InChIKey | JMCSIPCAWBECDX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |