C20H19Cl2N3O4S — CID 112822333
N-(2,4-dichlorophenyl)-1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-2-carboxamide (PubChem CID 112822333) has the molecular formula C20H19Cl2N3O4S and a molecular weight of 468.36 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-2-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 112822333 |
| Molecular Formula | C20H19Cl2N3O4S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-2-carboxamide |
| SMILES | CSc1ccc(C(=O)N2CCCCC2C(=O)Nc2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19Cl2N3O4S/c1-30-18-8-5-12(10-17(18)25(28)29)20(27)24-9-3-2-4-16(24)19(26)23-15-7-6-13(21)11-14(15)22/h5-8,10-11,16H,2-4,9H2,1H3,(H,23,26) |
| InChIKey | UAYWBFQIDNTFPZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|