C23H33N3O — CID 112823323
2-[4-(2-adamantylamino)piperidin-1-yl]-N-phenylacetamide (PubChem CID 112823323) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 2-[4-(2-adamantylamino)piperidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-(2-adamantylamino)piperidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 112823323 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 2-[4-(2-adamantylamino)piperidin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCC(NC2C3CC4CC(C3)CC2C4)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C23H33N3O/c27-22(24-20-4-2-1-3-5-20)15-26-8-6-21(7-9-26)25-23-18-11-16-10-17(13-18)14-19(23)12-16/h1-5,16-19,21,23,25H,6-15H2,(H,24,27) |
| InChIKey | CHDDSVZNTQNOCS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |