C23H31NO4 — CID 112823345
1-(3-butoxy-4-methoxyphenyl)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]methanamine (PubChem CID 112823345) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 1-(3-butoxy-4-methoxyphenyl)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]methanamine.
| Compound Name | 1-(3-butoxy-4-methoxyphenyl)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]methanamine |
|---|---|
| PubChem CID | 112823345 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-(3-butoxy-4-methoxyphenyl)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]methanamine |
| SMILES | CCCCOc1cc(CNCc2cc3c(cc2OC)CC(C)O3)ccc1OC |
| InChI | InChI=1S/C23H31NO4/c1-5-6-9-27-23-11-17(7-8-20(23)25-3)14-24-15-19-13-22-18(10-16(2)28-22)12-21(19)26-4/h7-8,11-13,16,24H,5-6,9-10,14-15H2,1-4H3 |
| InChIKey | RSRNUNZAOPWPBP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|