C18H24FN3O2S — CID 112825228
1-[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-(3-propan-2-yloxypropyl)urea (PubChem CID 112825228) has the molecular formula C18H24FN3O2S and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-(3-propan-2-yloxypropyl)urea.
| Compound Name | 1-[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-(3-propan-2-yloxypropyl)urea |
|---|---|
| PubChem CID | 112825228 |
| Molecular Formula | C18H24FN3O2S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-(3-propan-2-yloxypropyl)urea |
| SMILES | Cc1ccc(Cc2cnc(NC(=O)NCCCOC(C)C)s2)cc1F |
| InChI | InChI=1S/C18H24FN3O2S/c1-12(2)24-8-4-7-20-17(23)22-18-21-11-15(25-18)9-14-6-5-13(3)16(19)10-14/h5-6,10-12H,4,7-9H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | KOXLQXKWNDRXNY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|