C22H19FN4O2S — CID 78892937
N-(3-ethynylphenyl)-2-[[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]carbamoylamino]acetamide (PubChem CID 78892937) has the molecular formula C22H19FN4O2S and a molecular weight of 422.49 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-[[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]carbamoylamino]acetamide.
| Compound Name | N-(3-ethynylphenyl)-2-[[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 78892937 |
| Molecular Formula | C22H19FN4O2S |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-(3-ethynylphenyl)-2-[[5-[(3-fluoro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]carbamoylamino]acetamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)Nc2ncc(Cc3ccc(C)c(F)c3)s2)c1 |
| InChI | InChI=1S/C22H19FN4O2S/c1-3-15-5-4-6-17(9-15)26-20(28)13-24-21(29)27-22-25-12-18(30-22)10-16-8-7-14(2)19(23)11-16/h1,4-9,11-12H,10,13H2,2H3,(H,26,28)(H2,24,25,27,29) |
| InChIKey | UYHAYHXOZATHSC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|