C24H24N4OS — CID 112825394
4-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide (PubChem CID 112825394) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112825394 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide |
| SMILES | Cc1nc(CN2CCN(C(=O)Nc3cccc(C#Cc4ccccc4)c3)CC2)cs1 |
| InChI | InChI=1S/C24H24N4OS/c1-19-25-23(18-30-19)17-27-12-14-28(15-13-27)24(29)26-22-9-5-8-21(16-22)11-10-20-6-3-2-4-7-20/h2-9,16,18H,12-15,17H2,1H3,(H,26,29) |
| InChIKey | XWHQCMQPPXBIHU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|