C17H21IN4OS — CID 3802510
N-(2-iodophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carboxamide (PubChem CID 3802510) has the molecular formula C17H21IN4OS and a molecular weight of 456.35 g/mol. Its IUPAC name is N-(2-iodophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-(2-iodophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 3802510 |
| Molecular Formula | C17H21IN4OS |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | N-(2-iodophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carboxamide |
| SMILES | Cc1nc(CN2CCCN(C(=O)Nc3ccccc3I)CC2)cs1 |
| InChI | InChI=1S/C17H21IN4OS/c1-13-19-14(12-24-13)11-21-7-4-8-22(10-9-21)17(23)20-16-6-3-2-5-15(16)18/h2-3,5-6,12H,4,7-11H2,1H3,(H,20,23) |
| InChIKey | HFSGNUQYBNSCOH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|