C23H23N3OS — CID 3841398
1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one (PubChem CID 3841398) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one.
| Compound Name | 1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one |
|---|---|
| PubChem CID | 3841398 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one |
| SMILES | Cc1nc(CN2CCCN(C(=O)C#Cc3cccc4ccccc34)CC2)cs1 |
| InChI | InChI=1S/C23H23N3OS/c1-18-24-21(17-28-18)16-25-12-5-13-26(15-14-25)23(27)11-10-20-8-4-7-19-6-2-3-9-22(19)20/h2-4,6-9,17H,5,12-16H2,1H3 |
| InChIKey | LQXPKUTWZJRXCM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|