C24H25ClN4O — CID 3778508
1-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one (PubChem CID 3778508) has the molecular formula C24H25ClN4O and a molecular weight of 420.94 g/mol. Its IUPAC name is 1-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one.
| Compound Name | 1-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one |
|---|---|
| PubChem CID | 3778508 |
| Molecular Formula | C24H25ClN4O |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepan-1-yl]-3-naphthalen-1-ylprop-2-yn-1-one |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCCN(C(=O)C#Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H25ClN4O/c1-18-22(24(25)27(2)26-18)17-28-13-6-14-29(16-15-28)23(30)12-11-20-9-5-8-19-7-3-4-10-21(19)20/h3-5,7-10H,6,13-17H2,1-2H3 |
| InChIKey | AUIMIMNTUUNCEX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|