C18H30ClN5O2S — CID 3786242
ethyl 4-[[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanoate (PubChem CID 3786242) has the molecular formula C18H30ClN5O2S and a molecular weight of 415.99 g/mol. Its IUPAC name is ethyl 4-[[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanoate.
| Compound Name | ethyl 4-[[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanoate |
|---|---|
| PubChem CID | 3786242 |
| Molecular Formula | C18H30ClN5O2S |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | ethyl 4-[[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=S)N1CCCN(Cc2c(C)nn(C)c2Cl)CC1 |
| InChI | InChI=1S/C18H30ClN5O2S/c1-4-26-16(25)7-5-8-20-18(27)24-10-6-9-23(11-12-24)13-15-14(2)21-22(3)17(15)19/h4-13H2,1-3H3,(H,20,27) |
| InChIKey | KZHSTCBOOLRGPJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|