C26H24N2O6 — CID 11282594
2-[[(Z)-2-benzamido-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid (PubChem CID 11282594) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-[[(Z)-2-benzamido-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(Z)-2-benzamido-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11282594 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[[(Z)-2-benzamido-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)NC(Cc2ccccc2)C(=O)O)cc1O |
| InChI | InChI=1S/C26H24N2O6/c1-34-23-13-12-18(16-22(23)29)15-20(27-24(30)19-10-6-3-7-11-19)25(31)28-21(26(32)33)14-17-8-4-2-5-9-17/h2-13,15-16,21,29H,14H2,1H3,(H,27,30)(H,28,31)(H,32,33)/b20-15- |
| InChIKey | HFULWFWZVQBILT-HKWRFOASSA-N |
| XLogP | 2.98 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|