C16H23BrN2O3S — CID 112826333
2-[(4-bromophenyl)methylsulfonyl]-N-methyl-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 112826333) has the molecular formula C16H23BrN2O3S and a molecular weight of 403.34 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfonyl]-N-methyl-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfonyl]-N-methyl-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 112826333 |
| Molecular Formula | C16H23BrN2O3S |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfonyl]-N-methyl-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | CN1CCC(N(C)C(=O)CS(=O)(=O)Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H23BrN2O3S/c1-18-9-7-15(8-10-18)19(2)16(20)12-23(21,22)11-13-3-5-14(17)6-4-13/h3-6,15H,7-12H2,1-2H3 |
| InChIKey | FRNOKBDLMNTGDH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |