C16H22ClNO3S — CID 78852588
2-[(4-chlorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide (PubChem CID 78852588) has the molecular formula C16H22ClNO3S and a molecular weight of 343.88 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 78852588 |
| Molecular Formula | C16H22ClNO3S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)CS(=O)(=O)Cc1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C16H22ClNO3S/c1-18(15-5-3-2-4-6-15)16(19)12-22(20,21)11-13-7-9-14(17)10-8-13/h7-10,15H,2-6,11-12H2,1H3 |
| InChIKey | OIPVHWMGMRHJRO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |