C16H22Cl2N2O3S — CID 28633074
N-cyclohexyl-2-(2,5-dichloro-N-methylsulfonylanilino)-N-methylacetamide (PubChem CID 28633074) has the molecular formula C16H22Cl2N2O3S and a molecular weight of 393.34 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,5-dichloro-N-methylsulfonylanilino)-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-(2,5-dichloro-N-methylsulfonylanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 28633074 |
| Molecular Formula | C16H22Cl2N2O3S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-cyclohexyl-2-(2,5-dichloro-N-methylsulfonylanilino)-N-methylacetamide |
| SMILES | CN(C(=O)CN(c1cc(Cl)ccc1Cl)S(C)(=O)=O)C1CCCCC1 |
| InChI | InChI=1S/C16H22Cl2N2O3S/c1-19(13-6-4-3-5-7-13)16(21)11-20(24(2,22)23)15-10-12(17)8-9-14(15)18/h8-10,13H,3-7,11H2,1-2H3 |
| InChIKey | FBCCMOJLTHUWII-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |