C16H21ClFNO3S — CID 78852410
2-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide (PubChem CID 78852410) has the molecular formula C16H21ClFNO3S and a molecular weight of 361.87 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 78852410 |
| Molecular Formula | C16H21ClFNO3S |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)CS(=O)(=O)Cc1c(F)cccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C16H21ClFNO3S/c1-19(12-6-3-2-4-7-12)16(20)11-23(21,22)10-13-14(17)8-5-9-15(13)18/h5,8-9,12H,2-4,6-7,10-11H2,1H3 |
| InChIKey | RVRSUARUTRPWQZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |