C19H28ClFN2O2S — CID 50848099
1-[[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]azepane (PubChem CID 50848099) has the molecular formula C19H28ClFN2O2S and a molecular weight of 402.96 g/mol. Its IUPAC name is 1-[[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]azepane.
| Compound Name | 1-[[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]azepane |
|---|---|
| PubChem CID | 50848099 |
| Molecular Formula | C19H28ClFN2O2S |
| Molecular Weight | 402.96 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]azepane |
| SMILES | O=S(=O)(Cc1c(F)cccc1Cl)N1CCC(CN2CCCCCC2)CC1 |
| InChI | InChI=1S/C19H28ClFN2O2S/c20-18-6-5-7-19(21)17(18)15-26(24,25)23-12-8-16(9-13-23)14-22-10-3-1-2-4-11-22/h5-7,16H,1-4,8-15H2 |
| InChIKey | ZDLVWXCTVHHHDY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |