C21H32ClFN2O3S — CID 133239597
1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-4-carboxamide (PubChem CID 133239597) has the molecular formula C21H32ClFN2O3S and a molecular weight of 447.02 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133239597 |
| Molecular Formula | C21H32ClFN2O3S |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-4-carboxamide |
| SMILES | CCCCC(CC)CNC(=O)C1CCN(S(=O)(=O)Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C21H32ClFN2O3S/c1-3-5-7-16(4-2)14-24-21(26)17-10-12-25(13-11-17)29(27,28)15-18-19(22)8-6-9-20(18)23/h6,8-9,16-17H,3-5,7,10-15H2,1-2H3,(H,24,26) |
| InChIKey | WHCDOIKAPOZZQA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |