C21H32Cl2N2O3S — CID 133164334
1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-3-carboxamide (PubChem CID 133164334) has the molecular formula C21H32Cl2N2O3S and a molecular weight of 463.47 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-3-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133164334 |
| Molecular Formula | C21H32Cl2N2O3S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-ethylhexyl)piperidine-3-carboxamide |
| SMILES | CCCCC(CC)CNC(=O)C1CCCN(S(=O)(=O)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C21H32Cl2N2O3S/c1-3-5-7-16(4-2)13-24-21(26)18-8-6-11-25(14-18)29(27,28)15-17-9-10-19(22)20(23)12-17/h9-10,12,16,18H,3-8,11,13-15H2,1-2H3,(H,24,26) |
| InChIKey | VLFKSCYJXVYBPT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |