C21H34N2O3S2 — CID 133211188
N-(2-ethylhexyl)-1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 133211188) has the molecular formula C21H34N2O3S2 and a molecular weight of 426.65 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-ethylhexyl)-1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 133211188 |
| Molecular Formula | C21H34N2O3S2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-(2-ethylhexyl)-1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCCCC(CC)CNC(=O)C1CCN(S(=O)(=O)c2ccc(SC)cc2)CC1 |
| InChI | InChI=1S/C21H34N2O3S2/c1-4-6-7-17(5-2)16-22-21(24)18-12-14-23(15-13-18)28(25,26)20-10-8-19(27-3)9-11-20/h8-11,17-18H,4-7,12-16H2,1-3H3,(H,22,24) |
| InChIKey | JBRKGAKMSQTDHA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |