C19H32ClN3O3S — CID 119666450
N-(1-aminohexan-2-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119666450) has the molecular formula C19H32ClN3O3S and a molecular weight of 418.00 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119666450 |
| Molecular Formula | C19H32ClN3O3S |
| Molecular Weight | 418.00 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)C1CCN(S(=O)(=O)c2ccc(C)cc2)CC1.Cl |
| InChI | InChI=1S/C19H31N3O3S.ClH/c1-3-4-5-17(14-20)21-19(23)16-10-12-22(13-11-16)26(24,25)18-8-6-15(2)7-9-18;/h6-9,16-17H,3-5,10-14,20H2,1-2H3,(H,21,23);1H |
| InChIKey | XRUVVAMLOHHQCM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.00 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |