C23H37N3O4S2 — CID 3750650
1-(4-methylphenyl)sulfonyl-N-[4-methylsulfanyl-1-oxo-1-(pentylamino)butan-2-yl]piperidine-4-carboxamide (PubChem CID 3750650) has the molecular formula C23H37N3O4S2 and a molecular weight of 483.70 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[4-methylsulfanyl-1-oxo-1-(pentylamino)butan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[4-methylsulfanyl-1-oxo-1-(pentylamino)butan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3750650 |
| Molecular Formula | C23H37N3O4S2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[4-methylsulfanyl-1-oxo-1-(pentylamino)butan-2-yl]piperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C(CCSC)NC(=O)C1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H37N3O4S2/c1-4-5-6-14-24-23(28)21(13-17-31-3)25-22(27)19-11-15-26(16-12-19)32(29,30)20-9-7-18(2)8-10-20/h7-10,19,21H,4-6,11-17H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | YCWAYHBNNWLBAD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|