C25H39N3O6S2 — CID 3796792
2-[[1-[2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoyl]piperidine-4-carbonyl]amino]heptanoic acid (PubChem CID 3796792) has the molecular formula C25H39N3O6S2 and a molecular weight of 541.74 g/mol. Its IUPAC name is 2-[[1-[2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoyl]piperidine-4-carbonyl]amino]heptanoic acid.
| Compound Name | 2-[[1-[2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoyl]piperidine-4-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 3796792 |
| Molecular Formula | C25H39N3O6S2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-[[1-[2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoyl]piperidine-4-carbonyl]amino]heptanoic acid |
| SMILES | CCCCCC(NC(=O)C1CCN(C(=O)C(CCSC)NS(=O)(=O)c2ccc(C)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C25H39N3O6S2/c1-4-5-6-7-22(25(31)32)26-23(29)19-12-15-28(16-13-19)24(30)21(14-17-35-3)27-36(33,34)20-10-8-18(2)9-11-20/h8-11,19,21-22,27H,4-7,12-17H2,1-3H3,(H,26,29)(H,31,32) |
| InChIKey | CNYXXXHERLUVFC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|