C21H33ClN2O3S — CID 133166801
2-chloro-N-(2-ethylhexyl)-5-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 133166801) has the molecular formula C21H33ClN2O3S and a molecular weight of 429.03 g/mol. Its IUPAC name is 2-chloro-N-(2-ethylhexyl)-5-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | 2-chloro-N-(2-ethylhexyl)-5-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 133166801 |
| Molecular Formula | C21H33ClN2O3S |
| Molecular Weight | 429.03 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-chloro-N-(2-ethylhexyl)-5-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCCCC(CC)CNC(=O)c1cc(S(=O)(=O)N2CCC(C)CC2)ccc1Cl |
| InChI | InChI=1S/C21H33ClN2O3S/c1-4-6-7-17(5-2)15-23-21(25)19-14-18(8-9-20(19)22)28(26,27)24-12-10-16(3)11-13-24/h8-9,14,16-17H,4-7,10-13,15H2,1-3H3,(H,23,25) |
| InChIKey | QFIDEGJWYXPWTB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |