C19H27FN2O3 — CID 112826684
N-[2-(4-fluorophenoxy)ethyl]-N-methyl-5-oxo-1-pentan-3-ylpyrrolidine-3-carboxamide (PubChem CID 112826684) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-N-methyl-5-oxo-1-pentan-3-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-N-methyl-5-oxo-1-pentan-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 112826684 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-N-methyl-5-oxo-1-pentan-3-ylpyrrolidine-3-carboxamide |
| SMILES | CCC(CC)N1CC(C(=O)N(C)CCOc2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C19H27FN2O3/c1-4-16(5-2)22-13-14(12-18(22)23)19(24)21(3)10-11-25-17-8-6-15(20)7-9-17/h6-9,14,16H,4-5,10-13H2,1-3H3 |
| InChIKey | QRSPTHPQTMOXGO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |