About 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide
2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 112827270) has the molecular formula C21H21BrN2O3S2
and a molecular weight of 493.45 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 112827270 |
| Molecular Formula | C21H21BrN2O3S2 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(C)c1sc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H21BrN2O3S2/c1-14(2)20-19(16-6-4-3-5-7-16)24-21(28-20)23-18(25)13-29(26,27)12-15-8-10-17(22)11-9-15/h3-11,14H,12-13H2,1-2H3,(H,23,24,25) |
| InChIKey | APQDTMWZQONDHF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide (CID 112827270) is 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide is CC(C)c1sc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)nc1-c1ccccc1.
What is the InChIKey of 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide?
The InChIKey is APQDTMWZQONDHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21BrN2O3S2/c1-14(2)20-19(16-6-4-3-5-7-16)24-21(28-20)23-18(25)13-29(26,27)12-15-8-10-17(22)11-9-15/h3-11,14H,12-13H2,1-2H3,(H,23,24,25).
What are the key properties of 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide?
2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide has a molecular weight of 493.45 g/mol, XLogP of 5.25, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromophenyl)methylsulfonyl]-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 112827270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).