C27H38N6O2 — CID 112829656
N-phenyl-2-[4-[3-(4-phenylpiperazin-1-yl)propylcarbamoylamino]piperidin-1-yl]acetamide (PubChem CID 112829656) has the molecular formula C27H38N6O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-phenyl-2-[4-[3-(4-phenylpiperazin-1-yl)propylcarbamoylamino]piperidin-1-yl]acetamide.
| Compound Name | N-phenyl-2-[4-[3-(4-phenylpiperazin-1-yl)propylcarbamoylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 112829656 |
| Molecular Formula | C27H38N6O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | N-phenyl-2-[4-[3-(4-phenylpiperazin-1-yl)propylcarbamoylamino]piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(NC(=O)NCCCN2CCN(c3ccccc3)CC2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C27H38N6O2/c34-26(29-23-8-3-1-4-9-23)22-32-16-12-24(13-17-32)30-27(35)28-14-7-15-31-18-20-33(21-19-31)25-10-5-2-6-11-25/h1-6,8-11,24H,7,12-22H2,(H,29,34)(H2,28,30,35) |
| InChIKey | PVRWJHZDROFVFD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|