C25H23F2N3O3 — CID 112830739
1-[2-(difluoromethoxy)benzoyl]-N-[4-(pyridin-4-ylmethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 112830739) has the molecular formula C25H23F2N3O3 and a molecular weight of 451.47 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)benzoyl]-N-[4-(pyridin-4-ylmethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(difluoromethoxy)benzoyl]-N-[4-(pyridin-4-ylmethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 112830739 |
| Molecular Formula | C25H23F2N3O3 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-[2-(difluoromethoxy)benzoyl]-N-[4-(pyridin-4-ylmethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cc2ccncc2)cc1)C1CCCN1C(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C25H23F2N3O3/c26-25(27)33-22-6-2-1-4-20(22)24(32)30-15-3-5-21(30)23(31)29-19-9-7-17(8-10-19)16-18-11-13-28-14-12-18/h1-2,4,6-14,21,25H,3,5,15-16H2,(H,29,31) |
| InChIKey | HETDOZSWKVRWTE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |