C21H28F2N2O3 — CID 78883609
N-(3-cyclopentylpropyl)-1-[2-(difluoromethoxy)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 78883609) has the molecular formula C21H28F2N2O3 and a molecular weight of 394.46 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-1-[2-(difluoromethoxy)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(3-cyclopentylpropyl)-1-[2-(difluoromethoxy)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 78883609 |
| Molecular Formula | C21H28F2N2O3 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-(3-cyclopentylpropyl)-1-[2-(difluoromethoxy)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCC1CCCC1)C1CCCN1C(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C21H28F2N2O3/c22-21(23)28-18-12-4-3-10-16(18)20(27)25-14-6-11-17(25)19(26)24-13-5-9-15-7-1-2-8-15/h3-4,10,12,15,17,21H,1-2,5-9,11,13-14H2,(H,24,26) |
| InChIKey | KEDMVDDRJWIGNA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|