C21H19ClF3N3O5 — CID 112831062
1-(5-chloro-2-methoxyphenyl)-N-[(2-nitrophenyl)methyl]-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 112831062) has the molecular formula C21H19ClF3N3O5 and a molecular weight of 485.85 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-[(2-nitrophenyl)methyl]-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-[(2-nitrophenyl)methyl]-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 112831062 |
| Molecular Formula | C21H19ClF3N3O5 |
| Molecular Weight | 485.85 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-[(2-nitrophenyl)methyl]-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1N1CC(C(=O)N(Cc2ccccc2[N+](=O)[O-])CC(F)(F)F)CC1=O |
| InChI | InChI=1S/C21H19ClF3N3O5/c1-33-18-7-6-15(22)9-17(18)27-11-14(8-19(27)29)20(30)26(12-21(23,24)25)10-13-4-2-3-5-16(13)28(31)32/h2-7,9,14H,8,10-12H2,1H3 |
| InChIKey | LVTONXZPGXFNPB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|