C23H27ClN6O2S — CID 11283174
N-(2-chloro-6-methylphenyl)-2-[[6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 11283174) has the molecular formula C23H27ClN6O2S and a molecular weight of 487.03 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 11283174 |
| Molecular Formula | C23H27ClN6O2S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)c1cnc(Nc2cccc(NCCCN3CCOCC3)n2)s1 |
| InChI | InChI=1S/C23H27ClN6O2S/c1-16-5-2-6-17(24)21(16)29-22(31)18-15-26-23(33-18)28-20-8-3-7-19(27-20)25-9-4-10-30-11-13-32-14-12-30/h2-3,5-8,15H,4,9-14H2,1H3,(H,29,31)(H2,25,26,27,28) |
| InChIKey | VRDHUYBHXDZLDI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|