C24H34N4O — CID 112831935
N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2-pyridin-4-ylazepane-1-carboxamide (PubChem CID 112831935) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2-pyridin-4-ylazepane-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2-pyridin-4-ylazepane-1-carboxamide |
|---|---|
| PubChem CID | 112831935 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2-pyridin-4-ylazepane-1-carboxamide |
| SMILES | CCc1ccc(C(CNC(=O)N2CCCCCC2c2ccncc2)N(C)C)cc1 |
| InChI | InChI=1S/C24H34N4O/c1-4-19-9-11-20(12-10-19)23(27(2)3)18-26-24(29)28-17-7-5-6-8-22(28)21-13-15-25-16-14-21/h9-16,22-23H,4-8,17-18H2,1-3H3,(H,26,29) |
| InChIKey | BAVPNMDUHHTUPO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |