C21H21BrN4O3S — CID 112832444
(4-benzylsulfonylpiperazin-1-yl)-[1-(4-bromophenyl)pyrazol-4-yl]methanone (PubChem CID 112832444) has the molecular formula C21H21BrN4O3S and a molecular weight of 489.40 g/mol. Its IUPAC name is (4-benzylsulfonylpiperazin-1-yl)-[1-(4-bromophenyl)pyrazol-4-yl]methanone.
| Compound Name | (4-benzylsulfonylpiperazin-1-yl)-[1-(4-bromophenyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 112832444 |
| Molecular Formula | C21H21BrN4O3S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (4-benzylsulfonylpiperazin-1-yl)-[1-(4-bromophenyl)pyrazol-4-yl]methanone |
| SMILES | O=C(c1cnn(-c2ccc(Br)cc2)c1)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H21BrN4O3S/c22-19-6-8-20(9-7-19)26-15-18(14-23-26)21(27)24-10-12-25(13-11-24)30(28,29)16-17-4-2-1-3-5-17/h1-9,14-15H,10-13,16H2 |
| InChIKey | UIQOWNVJILVWBL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |