C25H29N3O3 — CID 112832993
4-(2-ethoxyphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]butanamide (PubChem CID 112832993) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 112832993 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)Nc1ccc(-c2ncc3n2CCCC3)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-30-22-9-3-4-10-23(22)31-17-7-11-24(29)27-20-14-12-19(13-15-20)25-26-18-21-8-5-6-16-28(21)25/h3-4,9-10,12-15,18H,2,5-8,11,16-17H2,1H3,(H,27,29) |
| InChIKey | FBQZOZXYLBLXIF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|