C19H20BrN3O3 — CID 112834396
2-[(3-bromobenzoyl)amino]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 112834396) has the molecular formula C19H20BrN3O3 and a molecular weight of 418.29 g/mol. Its IUPAC name is 2-[(3-bromobenzoyl)amino]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 2-[(3-bromobenzoyl)amino]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 112834396 |
| Molecular Formula | C19H20BrN3O3 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[(3-bromobenzoyl)amino]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | CN(C)C(=O)CN(C)C(=O)c1ccccc1NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H20BrN3O3/c1-22(2)17(24)12-23(3)19(26)15-9-4-5-10-16(15)21-18(25)13-7-6-8-14(20)11-13/h4-11H,12H2,1-3H3,(H,21,25) |
| InChIKey | KZQDHALHJCBFSV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |