C22H19BrN2O2 — CID 32892148
2-benzamido-N-[(4-bromophenyl)methyl]-N-methylbenzamide (PubChem CID 32892148) has the molecular formula C22H19BrN2O2 and a molecular weight of 423.31 g/mol. Its IUPAC name is 2-benzamido-N-[(4-bromophenyl)methyl]-N-methylbenzamide.
| Compound Name | 2-benzamido-N-[(4-bromophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 32892148 |
| Molecular Formula | C22H19BrN2O2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-benzamido-N-[(4-bromophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Br)cc1)C(=O)c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19BrN2O2/c1-25(15-16-11-13-18(23)14-12-16)22(27)19-9-5-6-10-20(19)24-21(26)17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,24,26) |
| InChIKey | CVSMRKQYHACKGE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |