C27H29N3O3 — CID 17312196
N-benzyl-N-methyl-2-[[4-(pentanoylamino)benzoyl]amino]benzamide (PubChem CID 17312196) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[[4-(pentanoylamino)benzoyl]amino]benzamide.
| Compound Name | N-benzyl-N-methyl-2-[[4-(pentanoylamino)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 17312196 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-benzyl-N-methyl-2-[[4-(pentanoylamino)benzoyl]amino]benzamide |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)Nc2ccccc2C(=O)N(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-3-4-14-25(31)28-22-17-15-21(16-18-22)26(32)29-24-13-9-8-12-23(24)27(33)30(2)19-20-10-6-5-7-11-20/h5-13,15-18H,3-4,14,19H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | DUMZBYRUDMZATL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |