C23H22N4O4S — CID 112834641
4-(4-cyanophenyl)sulfonyl-N-[furan-2-yl(phenyl)methyl]piperazine-1-carboxamide (PubChem CID 112834641) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-(4-cyanophenyl)sulfonyl-N-[furan-2-yl(phenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-cyanophenyl)sulfonyl-N-[furan-2-yl(phenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112834641 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-(4-cyanophenyl)sulfonyl-N-[furan-2-yl(phenyl)methyl]piperazine-1-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCN(C(=O)NC(c3ccccc3)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c24-17-18-8-10-20(11-9-18)32(29,30)27-14-12-26(13-15-27)23(28)25-22(21-7-4-16-31-21)19-5-2-1-3-6-19/h1-11,16,22H,12-15H2,(H,25,28) |
| InChIKey | IAJFMSLXQAQOPJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |