C19H24BrN3O3 — CID 112834693
1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(2-morpholin-4-yl-1-phenylethyl)urea (PubChem CID 112834693) has the molecular formula C19H24BrN3O3 and a molecular weight of 422.32 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(2-morpholin-4-yl-1-phenylethyl)urea.
| Compound Name | 1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(2-morpholin-4-yl-1-phenylethyl)urea |
|---|---|
| PubChem CID | 112834693 |
| Molecular Formula | C19H24BrN3O3 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(2-morpholin-4-yl-1-phenylethyl)urea |
| SMILES | CN(Cc1ccc(Br)o1)C(=O)NC(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C19H24BrN3O3/c1-22(13-16-7-8-18(20)26-16)19(24)21-17(15-5-3-2-4-6-15)14-23-9-11-25-12-10-23/h2-8,17H,9-14H2,1H3,(H,21,24) |
| InChIKey | HUEYJUMWIYERDG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |