C21H25BrN2O4 — CID 25485450
4-bromo-3,5-dimethoxy-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide (PubChem CID 25485450) has the molecular formula C21H25BrN2O4 and a molecular weight of 449.35 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 25485450 |
| Molecular Formula | C21H25BrN2O4 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H](CN2CCOCC2)c2ccccc2)cc(OC)c1Br |
| InChI | InChI=1S/C21H25BrN2O4/c1-26-18-12-16(13-19(27-2)20(18)22)21(25)23-17(15-6-4-3-5-7-15)14-24-8-10-28-11-9-24/h3-7,12-13,17H,8-11,14H2,1-2H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | BARHJZIZHFYSQE-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |