C24H30N2O4 — CID 18166790
3,4-dimethoxy-N-(2-morpholin-4-yl-1-phenylethyl)-5-prop-2-enylbenzamide (PubChem CID 18166790) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2-morpholin-4-yl-1-phenylethyl)-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-(2-morpholin-4-yl-1-phenylethyl)-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 18166790 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3,4-dimethoxy-N-(2-morpholin-4-yl-1-phenylethyl)-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NC(CN2CCOCC2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N2O4/c1-4-8-19-15-20(16-22(28-2)23(19)29-3)24(27)25-21(18-9-6-5-7-10-18)17-26-11-13-30-14-12-26/h4-7,9-10,15-16,21H,1,8,11-14,17H2,2-3H3,(H,25,27) |
| InChIKey | RVHIIIPMLQEIKE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|