C18H19N5O4S — CID 112835204
5-methyl-4-pyrrolidin-1-ylsulfonyl-N-[2-(triazol-1-yl)phenyl]furan-2-carboxamide (PubChem CID 112835204) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is 5-methyl-4-pyrrolidin-1-ylsulfonyl-N-[2-(triazol-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-methyl-4-pyrrolidin-1-ylsulfonyl-N-[2-(triazol-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 112835204 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-methyl-4-pyrrolidin-1-ylsulfonyl-N-[2-(triazol-1-yl)phenyl]furan-2-carboxamide |
| SMILES | Cc1oc(C(=O)Nc2ccccc2-n2ccnn2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C18H19N5O4S/c1-13-17(28(25,26)22-9-4-5-10-22)12-16(27-13)18(24)20-14-6-2-3-7-15(14)23-11-8-19-21-23/h2-3,6-8,11-12H,4-5,9-10H2,1H3,(H,20,24) |
| InChIKey | HUSWTJDOWYNJRG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |