C28H27ClN4O4 — CID 11283776
N-[4-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide (PubChem CID 11283776) has the molecular formula C28H27ClN4O4 and a molecular weight of 519.00 g/mol. Its IUPAC name is N-[4-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide.
| Compound Name | N-[4-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 11283776 |
| Molecular Formula | C28H27ClN4O4 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-[4-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide |
| SMILES | CC(=O)N1N=C(c2ccc(NC(=O)C(c3ccc(Cl)cc3)C(C)C)cc2)CC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H27ClN4O4/c1-17(2)27(20-8-12-21(29)13-9-20)28(35)30-22-14-10-19(11-15-22)24-16-26(32(31-24)18(3)34)23-6-4-5-7-25(23)33(36)37/h4-15,17,26-27H,16H2,1-3H3,(H,30,35) |
| InChIKey | QWHCSDJBVAXUKJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|