C26H19ClN4O4 — CID 136798762
3-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]-7-chloro-4-phenyl-1H-quinolin-2-one (PubChem CID 136798762) has the molecular formula C26H19ClN4O4 and a molecular weight of 486.92 g/mol. Its IUPAC name is 3-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]-7-chloro-4-phenyl-1H-quinolin-2-one.
| Compound Name | 3-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]-7-chloro-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 136798762 |
| Molecular Formula | C26H19ClN4O4 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 3-[2-acetyl-3-(2-nitrophenyl)-3,4-dihydropyrazol-5-yl]-7-chloro-4-phenyl-1H-quinolin-2-one |
| SMILES | CC(=O)N1N=C(c2c(-c3ccccc3)c3ccc(Cl)cc3[nH]c2=O)CC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19ClN4O4/c1-15(32)30-23(19-9-5-6-10-22(19)31(34)35)14-21(29-30)25-24(16-7-3-2-4-8-16)18-12-11-17(27)13-20(18)28-26(25)33/h2-13,23H,14H2,1H3,(H,28,33) |
| InChIKey | PHOUZSILEKFOBF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|