C23H31N3O — CID 112839494
2-(azepan-1-yl)-N-[4-[(2,4-dimethylphenyl)methylamino]phenyl]acetamide (PubChem CID 112839494) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[4-[(2,4-dimethylphenyl)methylamino]phenyl]acetamide.
| Compound Name | 2-(azepan-1-yl)-N-[4-[(2,4-dimethylphenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 112839494 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 2-(azepan-1-yl)-N-[4-[(2,4-dimethylphenyl)methylamino]phenyl]acetamide |
| SMILES | Cc1ccc(CNc2ccc(NC(=O)CN3CCCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H31N3O/c1-18-7-8-20(19(2)15-18)16-24-21-9-11-22(12-10-21)25-23(27)17-26-13-5-3-4-6-14-26/h7-12,15,24H,3-6,13-14,16-17H2,1-2H3,(H,25,27) |
| InChIKey | QLGMGAYQMDIWNR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |