C23H30N4O2 — CID 120669658
2-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-(4-methylphenyl)acetamide (PubChem CID 120669658) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-(4-methylphenyl)acetamide.
| Compound Name | 2-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 120669658 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(N)C(=O)Nc2ccc(NC(=O)CN3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H30N4O2/c1-17-6-8-18(9-7-17)22(24)23(29)26-20-12-10-19(11-13-20)25-21(28)16-27-14-4-2-3-5-15-27/h6-13,22H,2-5,14-16,24H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | DWZOMIRVVQNBGA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |