C19H32Cl2N4O2 — CID 120502947
3-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-methylbutanamide;dihydrochloride (PubChem CID 120502947) has the molecular formula C19H32Cl2N4O2 and a molecular weight of 419.40 g/mol. Its IUPAC name is 3-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-methylbutanamide;dihydrochloride.
| Compound Name | 3-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120502947 |
| Molecular Formula | C19H32Cl2N4O2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-amino-N-[4-[[2-(azepan-1-yl)acetyl]amino]phenyl]-2-methylbutanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)Nc1ccc(NC(=O)CN2CCCCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H30N4O2.2ClH/c1-14(15(2)20)19(25)22-17-9-7-16(8-10-17)21-18(24)13-23-11-5-3-4-6-12-23;;/h7-10,14-15H,3-6,11-13,20H2,1-2H3,(H,21,24)(H,22,25);2*1H |
| InChIKey | ZOOGIXPQNMLODR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |